tert-butylphenyldichlorosilane structure
|
Common Name | tert-butylphenyldichlorosilane | ||
|---|---|---|---|---|
| CAS Number | 17887-41-1 | Molecular Weight | 233.210 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 252.9±9.0 °C at 760 mmHg | |
| Molecular Formula | C10H14Cl2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.9±14.3 °C | |
| Name | tert-butyl-dichloro-phenylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 252.9±9.0 °C at 760 mmHg |
| Molecular Formula | C10H14Cl2Si |
| Molecular Weight | 233.210 |
| Flash Point | 101.9±14.3 °C |
| Exact Mass | 232.024185 |
| LogP | 6.16 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | OCXPCSGIIJESOA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](Cl)(Cl)c1ccccc1 |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 2987 |
| HS Code | 2931900090 |
|
~81%
tert-butylpheny... CAS#:17887-41-1 |
| Literature: Gmelin Handbook: Si: MVol.C, 58, page 165 - 167 Full Text Show Details Dow Corning Corp. Patent: GB657442 , 1951 ; C., 1952 , p. 7092 |
|
~%
tert-butylpheny... CAS#:17887-41-1 |
| Literature: Scholz, Stefan; Saenger, Inge; Schoedel, Frauke; Bolte, Michael; Lerner, Hans-Wolfram Inorganic Chemistry Communications, 2014 , vol. 44, p. 50 - 52 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| tert-butylphenyldichlorosilane |
| Silane, tert-butyldichlorophenyl- |
| phenyl-tert-butyldichlorosilane |
| tert-Butylphenylchlorosilane |
| tert-Butyl(dichloro)phenylsilane |
| Silane,tert-butyldichlorophenyl |
| tert-Butyl-dichlor-phenyl-silan |
| Silane, dichloro(1,1-dimethylethyl)phenyl- |
| t-butyldichlorophenylsilane |
| t-bu(ph)SiCl3 |
| tert-butyl-dichloro-phenyl-silane |
| Dichloro(2-methyl-2-propanyl)phenylsilane |
| EINECS 241-835-2 |
| Benzene, [dichloro(1,1-dimethylethyl)silyl]- |