tris(trimethylsiloxy)chlorosilane structure
|
Common Name | tris(trimethylsiloxy)chlorosilane | ||
|---|---|---|---|---|
| CAS Number | 17905-99-6 | Molecular Weight | 331.104 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 240.9±23.0 °C at 760 mmHg | |
| Molecular Formula | C9H27ClO3Si4 | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 83.8±14.7 °C | |
| Name | chloro-tris(trimethylsilyloxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 240.9±23.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C9H27ClO3Si4 |
| Molecular Weight | 331.104 |
| Flash Point | 83.8±14.7 °C |
| Exact Mass | 330.072571 |
| PSA | 27.69000 |
| LogP | 7.53 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.420 |
| InChIKey | BBCITGBFGUITMR-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](Cl)(O[Si](C)(C)C)O[Si](C)(C)C |
| Risk Phrases | R34 |
|---|---|
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 2987 |
| Packaging Group | II |
| HS Code | 2934999090 |
|
~96%
tris(trimethyls... CAS#:17905-99-6 |
| Literature: Varaprath, Sudarsanan; Stutts, Debra H. Journal of Organometallic Chemistry, 2007 , vol. 692, # 10 p. 1892 - 1897 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Chlor-trimethylsiloxy-silan |
| TRIS(TRIMETHYLSILOXY)CHLOROSILANE |
| Trisiloxane, 3-chloro-1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy]- |
| Chlor-tris-trimethylsilyloxy-silan |
| Tris-trimethylsiloxy-chlorsilan |
| MFCD00054864 |
| 3-Chloro-1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy]trisiloxane |