3-[(3-methoxyphenyl)methylidene]-2-benzofuran-1-one structure
|
Common Name | 3-[(3-methoxyphenyl)methylidene]-2-benzofuran-1-one | ||
|---|---|---|---|---|
| CAS Number | 17910-70-2 | Molecular Weight | 252.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(3-methoxyphenyl)methylidene]-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12O3 |
|---|---|
| Molecular Weight | 252.26500 |
| Exact Mass | 252.07900 |
| PSA | 35.53000 |
| LogP | 3.36370 |
| InChIKey | XJNLGILMYISDGH-UHFFFAOYSA-N |
| SMILES | COc1cccc(C=C2OC(=O)c3ccccc32)c1 |
|
~74%
3-[(3-methoxyph... CAS#:17910-70-2 |
| Literature: Noda, Masaki; Yamaguchi, Minoru; Ando, Eiji; Takeda, Kenji; Nokihara, Kiyoshi Journal of Organic Chemistry, 1994 , vol. 59, # 26 p. 7968 - 7975 |
|
~64%
3-[(3-methoxyph... CAS#:17910-70-2 |
| Literature: Merck and Co., Inc. Patent: US4399141 A1, 1983 ; |
| 3-methoxybenzalphthalide |