4,7-Decanediol,2,4,7,9-tetramethyl- structure
|
Common Name | 4,7-Decanediol,2,4,7,9-tetramethyl- | ||
|---|---|---|---|---|
| CAS Number | 17913-76-7 | Molecular Weight | 230.38700 | |
| Density | 0.901g/cm3 | Boiling Point | 283.6ºC at 760mmHg | |
| Molecular Formula | C14H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.8ºC | |
| Name | 2,4,7,9-tetramethyldecane-4,7-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.901g/cm3 |
|---|---|
| Boiling Point | 283.6ºC at 760mmHg |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.38700 |
| Flash Point | 114.8ºC |
| Exact Mass | 230.22500 |
| PSA | 40.46000 |
| LogP | 3.36080 |
| Vapour Pressure | 0.000365mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | BTRWELPXUDWAGW-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)(O)CCC(C)(O)CC(C)C |
| HS Code | 2905399090 |
|---|
|
~%
4,7-Decanediol,... CAS#:17913-76-7 |
| Literature: Tedeschi,R.J. Journal of Organic Chemistry, 1962 , vol. 27, p. 2398 - 2402 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2905399090 |
|---|---|
| Summary | 2905399090 other diols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4,7-Decanediol,2,4,7,9-tetramethyl |
| 2,4,7,9-Tetramethyl-decan-4,7-diol |
| 2,4,7,9-tetramethyl-decane-4,7-diol |