diphenylvinylethoxysilane structure
|
Common Name | diphenylvinylethoxysilane | ||
|---|---|---|---|---|
| CAS Number | 17933-85-6 | Molecular Weight | 254.399 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 295.7±13.0 °C at 760 mmHg | |
| Molecular Formula | C16H18OSi | Melting Point | <0°C | |
| MSDS | N/A | Flash Point | 131.1±10.0 °C | |
| Name | ethenyl-ethoxy-diphenylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 295.7±13.0 °C at 760 mmHg |
| Melting Point | <0°C |
| Molecular Formula | C16H18OSi |
| Molecular Weight | 254.399 |
| Flash Point | 131.1±10.0 °C |
| Exact Mass | 254.112686 |
| PSA | 9.23000 |
| LogP | 6.25 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | GGJQEMXRDJPGAH-UHFFFAOYSA-N |
| SMILES | C=C[Si](OCC)(c1ccccc1)c1ccccc1 |
|
~67%
diphenylvinylet... CAS#:17933-85-6 |
| Literature: Ohshita, Joji; Taketsugu, Ryosuke; Nakahara, Yuki; Kunai, Atsutaka Journal of Organometallic Chemistry, 2004 , vol. 689, # 20 p. 3258 - 3264 |
|
~%
diphenylvinylet... CAS#:17933-85-6 |
| Literature: Journal of Organometallic Chemistry, , vol. 689, # 20 p. 3258 - 3264 |
|
~%
diphenylvinylet... CAS#:17933-85-6 |
| Literature: Journal of Organometallic Chemistry, , vol. 689, # 20 p. 3258 - 3264 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Aethoxy-diphenyl-vinyl-silan |
| vinyldiphenylethoxysilane |
| Benzene, 1,1'-(ethenylethoxysilylene)bis- |
| Ethoxy(diphenyl)vinylsilane |
| (Ethoxy)diphenylvinylsilane |
| Silane,ethenylethoxydiphenyl |
| Ethoxydiphenylvinylsilan |
| EINECS 241-870-3 |
| diphenylvinylethoxysilane |
| Silane, ethenylethoxydiphenyl- |
| MFCD00053753 |
| Ethenyl-ethoxy-diphenyl-silane |