Fingolimod phosphate-d4 structure
|
Common Name | Fingolimod phosphate-d4 | ||
|---|---|---|---|---|
| CAS Number | 1794828-93-5 | Molecular Weight | 391.48 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 584.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C19H30D4NO5P | Melting Point | 202-208° C (dec.) | |
| MSDS | N/A | Flash Point | 307.1±32.9 °C | |
Use of Fingolimod phosphate-d4Fingolimod phosphate-d4 is deuterium labeled FTY720 Phosphate. |
| Name | rac FTY720-d4 Phosphate |
|---|---|
| Synonym | More Synonyms |
| Description | Fingolimod phosphate-d4 is deuterium labeled FTY720 Phosphate. |
|---|---|
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 584.2±60.0 °C at 760 mmHg |
| Melting Point | 202-208° C (dec.) |
| Molecular Formula | C19H30D4NO5P |
| Molecular Weight | 391.48 |
| Flash Point | 307.1±32.9 °C |
| Exact Mass | 391.242554 |
| LogP | 4.27 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | LRFKWQGGENFBFO-ONNKGWAKSA-N |
| SMILES | CCCCCCCCc1ccc(CCC(N)(CO)COP(=O)(O)O)cc1 |
| 2-Amino-2-[2-(4-octylphenyl)ethyl]-1,3-propanediol-d4 1-(Dihydrogen Phosphate) |
| 2-Amino-2-[hydroxy(2H2)methyl]-4-(4-octylphenyl)(1,1-2H2)butyl dihydrogen phosphate |
| 1,3-Propane-1,1,3,3-d4-diol, 2-amino-2-[2-(4-octylphenyl)ethyl]-, mono(dihydrogen phosphate) (ester) |