6-METHOXY-1 2 3 4-TETRAHYDRO-9H-PYRIDO-&
Modify Date: 2025-08-26 21:00:53
6-METHOXY-1 2 3 4-TETRAHYDRO-9H-PYRIDO-& structure
|
Common Name | 6-METHOXY-1 2 3 4-TETRAHYDRO-9H-PYRIDO-& | ||
|---|---|---|---|---|
| CAS Number | 17952-63-5 | Molecular Weight | 246.26200 | |
| Density | 1.36g/cm3 | Boiling Point | 524.8ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O3 | Melting Point | 217ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 271.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 524.8ºC at 760 mmHg |
| Melting Point | 217ºC (dec.)(lit.) |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.26200 |
| Flash Point | 271.2ºC |
| Exact Mass | 246.10000 |
| PSA | 74.35000 |
| LogP | 1.77670 |
| Vapour Pressure | 7.7E-12mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | GHEBCEHFQAHKRP-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCNC3C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~%
6-METHOXY-1 2 3... CAS#:17952-63-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 16, # 22 p. 5840 - 5843 |
CAS#:20315-68-8
CAS#:88704-39-6| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Inhibition of electric eel AChE using acetylcholine iodide as substrate measured ever...
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL2020010
|
|
Name: Inhibition of electric eel AChE using acetylcholine iodide as substrate at 10'-4 M me...
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL2020011
|
|
Name: Inhibition of MK2
Source: ChEMBL
Target: MAP kinase-activated protein kinase 2
External Id: CHEMBL922889
|
|
Name: Inhibition of human AChE by Ellman's method
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL2020014
|
|
Name: Inhibition of human AChE at 10'-4 M by Ellman's method
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL2020015
|
|
Name: Inhibition of Candida albicans isocitrate lyase
Source: ChEMBL
Target: Isocitrate lyase
External Id: CHEMBL1292116
|
|
Name: Inhibition of Staphylococcus aureus Sortase A
Source: ChEMBL
Target: Class A sortase SrtA
External Id: CHEMBL1292117
|
Total 7, Current Page 1 of 1
1
| 6-Methoxy-1,2,3,4-tetrahydro-9H-pyrido[3,4-b]indole-1-carboxylic acid |
| MFCD00010826 |
| 6-methoxy-1,2,3,4-tetrahydronorharman-1-carboxylic acid |
| 6-methoxy-1,2,3,4-tetrahydronorarmano-1-carboxylic acid |