bis(trimethylsilyl)hypoxathine structure
|
Common Name | bis(trimethylsilyl)hypoxathine | ||
|---|---|---|---|---|
| CAS Number | 17962-89-9 | Molecular Weight | 280.47400 | |
| Density | 1.09g/cm3 | Boiling Point | 316ºC at 760mmHg | |
| Molecular Formula | C11H20N4OSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.9ºC | |
| Name | bis(trimethylsilyl)hypoxathine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 316ºC at 760mmHg |
| Molecular Formula | C11H20N4OSi2 |
| Molecular Weight | 280.47400 |
| Flash Point | 144.9ºC |
| Exact Mass | 280.11800 |
| PSA | 52.71000 |
| LogP | 1.95900 |
| Vapour Pressure | 0.000422mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | GQQMYRBRLIEVPC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)Oc1ncnc2c1ncn2[Si](C)(C)C |
| HS Code | 2933990090 |
|---|
|
~%
bis(trimethylsi... CAS#:17962-89-9 |
| Literature: Madre, M.A.; Liepin'sh, E.E.; Zhuk, R.A.; Sakhartova, O.V.; Lidak, M.Yu. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1986 , vol. 22, # 4 p. 425 - 431 Khimiya Geterotsiklicheskikh Soedinenii, 1986 , vol. 22, # 4 p. 518 - 524 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(Trimethylsiloxy)-9-(trimethylsilyl)-9H-purine |
| 9-(trimethylsilyl)-6-[(trimethylsilyl)oxy]-9H-Purine |
| Einecs 241-888-1 |
| 9-trimethylsilanyl-6-trimethylsilanyloxy-9H-purine |
| 9H-Purine,9-(trimethylsilyl)-6-[(trimethylsilyl)oxy] |
| 9-(trimethylsilyl)-6-[(trimethylsilyl)oxy]-9h-purin |
| O,N9-bis(trimethylsilyl)hypoxanthine |
| O6,9-bis(Trimethylsilyl)hypoxanthine |