2-(5-methoxy-2-nitrophenyl)ethyl carbonochloridate structure
|
Common Name | 2-(5-methoxy-2-nitrophenyl)ethyl carbonochloridate | ||
|---|---|---|---|---|
| CAS Number | 179691-27-1 | Molecular Weight | 259.64300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5-methoxy-2-nitrophenyl)ethyl carbonochloridate |
|---|
| Molecular Formula | C10H10ClNO5 |
|---|---|
| Molecular Weight | 259.64300 |
| Exact Mass | 259.02500 |
| PSA | 81.35000 |
| LogP | 3.04450 |
| InChIKey | WKXAQUKPPFKQCH-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(CCOC(=O)Cl)c1 |
|
~96%
2-(5-methoxy-2-... CAS#:179691-27-1 |
| Literature: Pfleiderer; Wolfgang Patent: US5763599 A1, 1998 ; |
|
~%
2-(5-methoxy-2-... CAS#:179691-27-1 |
| Literature: Giegrich; Eisele-Buehler; Hermann; Kvasyuk; Charubala; Pfleiderer Nucleosides and Nucleotides, 1998 , vol. 17, # 9-11 p. 1987 - 1996 |
|
~%
2-(5-methoxy-2-... CAS#:179691-27-1 |
| Literature: Giegrich; Eisele-Buehler; Hermann; Kvasyuk; Charubala; Pfleiderer Nucleosides and Nucleotides, 1998 , vol. 17, # 9-11 p. 1987 - 1996 |