4-Methoxy-2-methyl-1-nitrobenzene structure
|
Common Name | 4-Methoxy-2-methyl-1-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 5367-32-8 | Molecular Weight | 167.162 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 280.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C8H9NO3 | Melting Point | 48-50 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 135.1±23.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Methyl-4-nitroanisole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 280.8±20.0 °C at 760 mmHg |
| Melting Point | 48-50 °C(lit.) |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.162 |
| Flash Point | 135.1±23.8 °C |
| Exact Mass | 167.058243 |
| PSA | 55.05000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | RTZOGYCMIMOVHU-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(C)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Design and synthesis of potent N1-substituted indole melatonin receptor agonists.
Chem. Commun. (Camb.) (3) , 382-3, (2003) The design and expeditious synthesis of two new indole analogs with up to 5-fold potency of that of melatonin is described. |
| WNR B1 DO1 |
| EINECS 226-357-4 |
| 4-Methoxy-2-methyl-1-nitrobenzene |
| 3-Methyl-4-Nitroanisole |
| 5-Methoxy-2-nitrotoluene |
| 5-Methoxy-2-ni |
| MFCD00007167 |
| Methyl 3-methyl-4-nitrophenyl ether |
| 1-Methoxy-3-methyl-4-nitrobenzene |
| Benzene, 4-methoxy-2-methyl-1-nitro- |