(Azidomethyl)phosphonic acid diethyl ester structure
|
Common Name | (Azidomethyl)phosphonic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 17982-55-7 | Molecular Weight | 193.14100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H12N3O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Diethyl azidomethyl phosphonate |
|---|
| Molecular Formula | C5H12N3O3P |
|---|---|
| Molecular Weight | 193.14100 |
| Exact Mass | 193.06200 |
| PSA | 95.09000 |
| LogP | 1.97306 |
| InChIKey | NLTDIBZJVFRPTB-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CN=[N+]=[N-])OCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |