diethyl-n-benzylideneaminomethylphosphonate structure
|
Common Name | diethyl-n-benzylideneaminomethylphosphonate | ||
|---|---|---|---|---|
| CAS Number | 50917-73-2 | Molecular Weight | 255.25000 | |
| Density | 1.1g/cm3 | Boiling Point | 349.8ºC at 760mmHg | |
| Molecular Formula | C12H18NO3P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 165.4ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | N-(diethoxyphosphorylmethyl)-1-phenylmethanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 349.8ºC at 760mmHg |
| Molecular Formula | C12H18NO3P |
| Molecular Weight | 255.25000 |
| Flash Point | 165.4ºC |
| Exact Mass | 255.10200 |
| PSA | 57.70000 |
| LogP | 3.32910 |
| Index of Refraction | 1.504 |
| InChIKey | REXOGTNRQYAOQG-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CN=Cc1ccccc1)OCC |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2810 6.1 / PGIII |
| HS Code | 2931900090 |
|
~99%
diethyl-n-benzy... CAS#:50917-73-2 |
| Literature: Wu, Shi-Hui; Sun, Wei-Quan; Zhang, Dan-Wei; Shu, Lian-He; Wu, Hou-Ming; Xu, Jing-Fei; Lao, Xia-Fei Journal of the Chemical Society - Perkin Transactions 1, 1998 , # 10 p. 1733 - 1738 |
|
~82%
diethyl-n-benzy... CAS#:50917-73-2 |
| Literature: Morimoto, Toshiaki; Sekiya, Minoru Chemistry Letters, 1985 , p. 1371 - 1372 |
|
~%
diethyl-n-benzy... CAS#:50917-73-2 |
| Literature: Ratcliffe; Christensen Tetrahedron Letters, 1973 , vol. No. 46, p. 4645 - 4648 |
|
~%
diethyl-n-benzy... CAS#:50917-73-2 |
| Literature: Gajda; Janik Polish Journal of Chemistry, 2005 , vol. 79, # 3 p. 493 - 498 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| diethyl (N-benzylideneaminomethyl)phosphonate |
| [(benzylidene-amino)-methyl]-phosphonic acid diethyl ester |
| Phosphonic acid,P-[[(phenylmethylene)amino]methyl]-,diethyl ester |
| diethyl 1-(N-benzylamino)methylphosphonate |
| Diethyl ((benzylideneamino)methyl)phosphonate |
| N-benzylidene diethyl aminomethyl phosphonate |
| diethyl-(N-benzylidenaminomethylphosphonate) |