4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide
Modify Date: 2026-09-22 11:12:52
![4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide Structure](https://www.chemsrc.com/extcaspic/428/1798677-84-5.png)
4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide structure
|
Common Name | 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1798677-84-5 | Molecular Weight | 385.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26F3N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H26F3N3O2 |
|---|---|
| Molecular Weight | 385.4 |
| InChIKey | XXRHZZUWJOUQFU-UHFFFAOYSA-N |
| SMILES | COC1CCN(C2CCN(C(=O)Nc3ccc(C(F)(F)F)cc3)CC2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide? |
| A: The English name of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide is 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide. |
| Q: What is the Chinese name of 1798677-84-5? |
| A: Chinese name of 1798677-84-5 is 1798677-84-5. |
| Q: What is the molecular formula of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide? |
| A: Molecular formula of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide is C19H26F3N3O2. |
| Q: What is the SMILES notation of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide? |
| A: SMILES notation of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide is COC1CCN(C2CCN(C(=O)Nc3ccc(C(F)(F)F)cc3)CC2)CC1. |
| Q: What is the InChIKey of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide? |
| A: InChIKey of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide is XXRHZZUWJOUQFU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide? |
| A: Molecular weight of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide is 385.4. |
| Q: What is the CAS number of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide? |
| A: CAS number of 4-methoxy-N-(4-(trifluoromethyl)phenyl)-[1,4'-bipiperidine]-1'-carboxamide is 1798677-84-5. |