Ethyl 9H-perfluorononanoate structure
|
Common Name | Ethyl 9H-perfluorononanoate | ||
|---|---|---|---|---|
| CAS Number | 1799-47-9 | Molecular Weight | 474.13900 | |
| Density | 1.572g/cm3 | Boiling Point | 112 °C | |
| Molecular Formula | C11H6F16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79.5ºC | |
| Name | Ethyl 9H-perfluorononanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.572g/cm3 |
|---|---|
| Boiling Point | 112 °C |
| Molecular Formula | C11H6F16O2 |
| Molecular Weight | 474.13900 |
| Flash Point | 79.5ºC |
| Exact Mass | 474.01100 |
| PSA | 26.30000 |
| LogP | 5.26170 |
| Vapour Pressure | 0.184mmHg at 25°C |
| Index of Refraction | 1.32 |
| InChIKey | HRSRZMSDVRJBEZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| Hazard Codes | F: Flammable; |
|---|---|
| HS Code | 2915900090 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanoate |
| MFCD00153152 |