N-(2-CARBOXYBENZOYL)-(-)-10,2-CAMPHORSULTAM structure
|
Common Name | N-(2-CARBOXYBENZOYL)-(-)-10,2-CAMPHORSULTAM | ||
|---|---|---|---|---|
| CAS Number | 179950-32-4 | Molecular Weight | 363.42800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO5S | Melting Point | 183 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1S,5R,7R)-4-(2-carboxybenzoyl)-3-thia-4-azatricyclo<5.2.1.01,5>decane 3,3-dioxide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 183 °C |
|---|---|
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.42800 |
| Exact Mass | 363.11400 |
| PSA | 100.13000 |
| LogP | 3.38400 |
| Index of Refraction | 1.659 |
| InChIKey | UJCSAJNSMWSFHF-YRILPIOLSA-N |
| SMILES | CC1(C)C2CCC13CS(=O)(=O)N(C(=O)c1ccccc1C(=O)O)C3C2 |
| HS Code | 2934999090 |
|---|
|
~%
N-(2-CARBOXYBEN... CAS#:179950-32-4 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 71, # 11 p. 2715 - 2720 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(2-Carboxybenzoyl)-(-)-10,2-caMphorsultaM |