(4-ethenylphenyl) trimethoxy-Silane structure
|
Common Name | (4-ethenylphenyl) trimethoxy-Silane | ||
|---|---|---|---|---|
| CAS Number | 18001-13-3 | Molecular Weight | 224.32800 | |
| Density | N/A | Boiling Point | 77 °C/0.2 mmHg | |
| Molecular Formula | C11H16O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-ethenylphenyl)-trimethoxysilane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 77 °C/0.2 mmHg |
|---|---|
| Molecular Formula | C11H16O3Si |
| Molecular Weight | 224.32800 |
| Exact Mass | 224.08700 |
| PSA | 27.69000 |
| LogP | 1.41470 |
| Index of Refraction | 1.50 |
| InChIKey | LTQBNYCMVZQRSD-UHFFFAOYSA-N |
| SMILES | C=Cc1ccc([Si](OC)(OC)OC)cc1 |
| HS Code | 2931900090 |
|---|
|
~8%
(4-ethenylpheny... CAS#:18001-13-3 |
| Literature: Fraunhofer-Gesellschaft zur Forderung der Angewandten Forschung e.V. Patent: US2003/139621 A1, 2003 ; |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| KBM1403 |
| p-styryltrimethoxysilane |
| Y 5772 |
| p-vinyl phenyl trimethoxysilane |