(4-Bromophenyl)(trimethoxy)silane structure
|
Common Name | (4-Bromophenyl)(trimethoxy)silane | ||
|---|---|---|---|---|
| CAS Number | 17043-05-9 | Molecular Weight | 277.187 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 230.5±23.0 °C at 760 mmHg | |
| Molecular Formula | C9H13BrO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93.2±22.6 °C | |
| Name | bromomethoxy-dimethoxy-phenylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 230.5±23.0 °C at 760 mmHg |
| Molecular Formula | C9H13BrO3Si |
| Molecular Weight | 277.187 |
| Flash Point | 93.2±22.6 °C |
| Exact Mass | 275.981720 |
| PSA | 27.69000 |
| LogP | 2.17 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | BRXDAEMGSYZHGK-UHFFFAOYSA-N |
| SMILES | CO[Si](OC)(OC)c1ccc(Br)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 9-16-36/39 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (4-Bromophenyl)(trimethoxy)silane |
| 4-bromophenyltrimethoxysilane |
| (ph-4-Br)Si(Ome)3 |
| (4-Brom-phenyl)-orthosiliconsaeure-trimethylester |
| Benzene, 1-bromo-4-(trimethoxysilyl)- |
| Silane,(4-bromophenyl)trimethoxy-(9CI) |
| 4-bromo-1-(trimethoxysilyl)benzene |
| 4-Brom-phenyl-monosilanorthosaeure-trimethylester |
| (4-Brom-phenyl)-trimethoxy-silan |
| 1-Bromo-4-trimethoxysilylbenzene |
| BROMOPHENYLTRIMETHOXYSILANE |
| Silane,(p-bromophenyl)trimethoxy-(8CI) |
| Benzene,1-bromo-4-(trimethoxysilyl) |