tert-Butyl (2-(4-aminophenyl)-2-methylpropyl)carbamate structure
|
Common Name | tert-Butyl (2-(4-aminophenyl)-2-methylpropyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 180081-10-1 | Molecular Weight | 264.363 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 412.8±38.0 °C at 760 mmHg | |
| Molecular Formula | C15H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.4±26.8 °C | |
| Name | tert-butyl N-[2-(4-aminophenyl)-2-methylpropyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.8±38.0 °C at 760 mmHg |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.363 |
| Flash Point | 203.4±26.8 °C |
| Exact Mass | 264.183777 |
| PSA | 64.35000 |
| LogP | 2.72 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | VAEAYMRALDLXDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(C)(C)c1ccc(N)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~85%
tert-Butyl (2-(... CAS#:180081-10-1 |
| Literature: Vertex Pharmaceuticals Incorported Patent: US2011/98311 A1, 2011 ; Title/Abstract Full Text Show Details Vertex Pharmaceuticals Incorporated Patent: US2012/309758 A1, 2012 ; US 20120309758 A1 |
|
~%
tert-Butyl (2-(... CAS#:180081-10-1 |
| Literature: US2011/98311 A1, ; |
|
~%
tert-Butyl (2-(... CAS#:180081-10-1 |
| Literature: US2011/98311 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-2-propanyl [2-(4-aminophenyl)-2-methylpropyl]carbamate |
| tert-Butyl (2-(4-aminophenyl)-2-methylpropyl)carbamate |
| tert-Butyl [2-(4-aminophenyl)-2-methylpropyl]carbamate |
| Carbamic acid, N-[2-(4-aminophenyl)-2-methylpropyl]-, 1,1-dimethylethyl ester |