4-(thiophen-2-ylmethylideneamino)benzoic acid structure
|
Common Name | 4-(thiophen-2-ylmethylideneamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 18015-03-7 | Molecular Weight | 231.27000 | |
| Density | 1.26g/cm3 | Boiling Point | 437.8ºC at 760 mmHg | |
| Molecular Formula | C12H9NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.6ºC | |
| Name | 4-(thiophen-2-ylmethylideneamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 437.8ºC at 760 mmHg |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.27000 |
| Flash Point | 218.6ºC |
| Exact Mass | 231.03500 |
| PSA | 77.90000 |
| LogP | 3.19690 |
| Vapour Pressure | 1.94E-08mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | NFKOTVHQEVUACX-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(N=Cc2cccs2)cc1 |
| HS Code | 2934999090 |
|---|
|
~90%
4-(thiophen-2-y... CAS#:18015-03-7 |
| Literature: Saeed, Ali A. H. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1984 , vol. 23, # 1 p. 92 - 93 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-thiophen-2-ylmethyleneamino-benzoic acid |