4-(naphthalen-2-ylmethylideneamino)benzoic acid structure
|
Common Name | 4-(naphthalen-2-ylmethylideneamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3782-78-3 | Molecular Weight | 275.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(naphthalen-2-ylmethylideneamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H13NO2 |
|---|---|
| Molecular Weight | 275.30100 |
| Exact Mass | 275.09500 |
| PSA | 49.66000 |
| LogP | 4.28860 |
| InChIKey | DBYLOATXXUAKHP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(N=Cc2ccc3ccccc3c2)cc1 |
| HS Code | 2925290090 |
|---|
|
~51%
4-(naphthalen-2... CAS#:3782-78-3 |
| Literature: Obali, Aslihan Yilmaz; Ucan, Halil Ismet Journal of Fluorescence, 2012 , vol. 22, # 5 p. 1357 - 1370 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-(naphthalen-2-ylmethyleneamino)benzoic acid |
| Benzoic acid,4-[(2-naphthalenylmethylene)amino] |
| 2-(4-Carboxy-phenyliminomethyl)-naphthalin |