S-(-)-LISURIDE structure
|
Common Name | S-(-)-LISURIDE | ||
|---|---|---|---|---|
| CAS Number | 18016-80-3 | Molecular Weight | 456.53500 | |
| Density | 1.23g/cm3 | Boiling Point | 603.4ºC at 760mmHg | |
| Molecular Formula | C24H32N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.7ºC | |
Use of S-(-)-LISURIDELisuride is an orally active dopamine D2 receptors agonist. Lisuride, as an ergot derivative, can be used for the research of Parkinson's disease, migraine, and high prolactin levels[1][2]. |
| Name | lisuride |
|---|---|
| Synonym | More Synonyms |
| Description | Lisuride is an orally active dopamine D2 receptors agonist. Lisuride, as an ergot derivative, can be used for the research of Parkinson's disease, migraine, and high prolactin levels[1][2]. |
|---|---|
| Related Catalog | |
| Target |
D2 Receptor |
| In Vivo | lisuride (30~100 μg/kg) decreases the rate of dopa formation[2]. |
| References |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 603.4ºC at 760mmHg |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.53500 |
| Flash Point | 318.7ºC |
| Exact Mass | 456.23700 |
| PSA | 125.97000 |
| LogP | 2.97230 |
| Vapour Pressure | 1.9E-15mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | BKRGVLQUQGGVSM-KBXCAEBGSA-N |
| SMILES | CCN(CC)C(=O)NC1C=C2c3cccc4[nH]cc(c34)CC2N(C)C1 |
|
~%
S-(-)-LISURIDE CAS#:18016-80-3 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 52, # 5 p. 1331 - 1339 |
| Lisurida |
| LISURIDE |
| 3-[(6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-yl]-1,1-diethylurea |
| Methylergol Carbamide |
| Lisuridum |
| Lysuride |
| Lysurid |