Sulfo-Cy5-tetrazine structure
|
Common Name | Sulfo-Cy5-tetrazine | ||
|---|---|---|---|---|
| CAS Number | 1801695-57-7 | Molecular Weight | 920.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H49N7O10S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfo-Cy5-tetrazineCy5 Tetrazine is a water-soluble, pH-insensitive from pH 4 to pH 10, far-red-fluorescent probe with excitation ideally suited for the 633 nm or 647 nm laser lines. Its absorption and emission spactra are almost identical to those of Alexa Fluor 647, CF 647 Dye, or any other Cyanine5 based fluorescent dyes. |
| Name | Sulfo-Cy5-tetrazine |
|---|
| Description | Cy5 Tetrazine is a water-soluble, pH-insensitive from pH 4 to pH 10, far-red-fluorescent probe with excitation ideally suited for the 633 nm or 647 nm laser lines. Its absorption and emission spactra are almost identical to those of Alexa Fluor 647, CF 647 Dye, or any other Cyanine5 based fluorescent dyes. |
|---|---|
| Related Catalog |
| Molecular Formula | C43H49N7O10S3 |
|---|---|
| Molecular Weight | 920.09 |
| InChIKey | TYHSHKVHPUEYMG-UHFFFAOYSA-N |
| SMILES | CC1(C)C(=CC=CC=CC2=[N+](CCCS(=O)(=O)O)c3ccc(S(=O)(=O)[O-])cc3C2(C)C)N(CCCCCC(=O)NCc2ccc(-c3nncnn3)cc2)c2ccc(S(=O)(=O)O)cc21 |