Sulfo-Cy5-Methyltetrazine
Modify Date: 2025-08-22 00:27:50
Sulfo-Cy5-Methyltetrazine structure
|
Common Name | Sulfo-Cy5-Methyltetrazine | ||
|---|---|---|---|---|
| CAS Number | 1801924-46-8 | Molecular Weight | 934.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C44H51N7O10S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfo-Cy5-MethyltetrazineSulfo-Cy5-Methyltetrazine is a click chemistry reagent containing a methyltetrazine group. Sulfo-Cy5-Methyltetrazine acts as a fluorophore linker for trans-cyclooctene-based labeling. Sulfo-Cy5-Methyltetrazine shows good stability at physiological pH and is also highly reactive towards cyclooctene. |
| Name | Sulfo-Cy5-Methyltetrazine |
|---|
| Description | Sulfo-Cy5-Methyltetrazine is a click chemistry reagent containing a methyltetrazine group. Sulfo-Cy5-Methyltetrazine acts as a fluorophore linker for trans-cyclooctene-based labeling. Sulfo-Cy5-Methyltetrazine shows good stability at physiological pH and is also highly reactive towards cyclooctene. |
|---|---|
| Related Catalog |
| Molecular Formula | C44H51N7O10S3 |
|---|---|
| Molecular Weight | 934.11 |
| InChIKey | ZXNMMOJPJIHIMB-UHFFFAOYSA-N |
| SMILES | Cc1nnc(-c2ccc(CNC(=O)CCCCC[N+]3=C(C=CC=CC=C4N(CCCS(=O)(=O)O)c5ccc(S(=O)(=O)O)cc5C4(C)C)C(C)(C)c4cc(S(=O)(=O)[O-])ccc43)cc2)nn1 |