fmoc-4-carboxymethyl-piperidine structure
|
Common Name | fmoc-4-carboxymethyl-piperidine | ||
|---|---|---|---|---|
| CAS Number | 180181-05-9 | Molecular Weight | 365.422 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 575.0±23.0 °C at 760 mmHg | |
| Molecular Formula | C22H23NO4 | Melting Point | 135-138ºC | |
| MSDS | Chinese USA | Flash Point | 301.6±22.6 °C | |
| Name | {1-[(9H-Fluoren-9-ylmethoxy)carbonyl]piperidin-4-yl}acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 575.0±23.0 °C at 760 mmHg |
| Melting Point | 135-138ºC |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.422 |
| Flash Point | 301.6±22.6 °C |
| Exact Mass | 365.162720 |
| PSA | 66.84000 |
| LogP | 3.76 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | CQAGUAUKAZHOSU-UHFFFAOYSA-N |
| SMILES | O=C(O)CC1CCN(C(=O)OCC2c3ccccc3-c3ccccc32)CC1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Piperidineacetic acid, 1-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| MFCD00273478 |
| 2-[1-(9H-fluoren-9-ylmethoxycarbonyl)piperidin-4-yl]acetic acid |
| 2-(1-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperidin-4-yl)acetic acid |
| {1-[(9H-Fluoren-9-ylmethoxy)carbonyl]piperidin-4-yl}acetic acid |
| {1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-piperidinyl}acetic acid |