3-amino-3-(4-trifluoromethyl-phenyl)-propionic acid
Modify Date: 2025-08-21 10:46:23
3-amino-3-(4-trifluoromethyl-phenyl)-propionic acid structure
|
Common Name | 3-amino-3-(4-trifluoromethyl-phenyl)-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 180263-44-9 | Molecular Weight | 233.187 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 317.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H10F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.5±27.9 °C | |
| Name | 3-amino-3-[4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 317.0±42.0 °C at 760 mmHg |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.187 |
| Flash Point | 145.5±27.9 °C |
| Exact Mass | 233.066360 |
| PSA | 63.32000 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | ABDRZHVLIRZFQO-UHFFFAOYSA-N |
| SMILES | NC(CC(=O)O)c1ccc(C(F)(F)F)cc1 |
|
~43%
3-amino-3-(4-tr... CAS#:180263-44-9 |
| Literature: Rodriguez-Mata, Maria; Garcia-Urdiales, Eduardo; Gotor-Fernandez, Vicente; Gotor, Vicente Advanced Synthesis and Catalysis, 2010 , vol. 352, # 2-3 p. 395 - 406 |
|
~44%
3-amino-3-(4-tr... CAS#:180263-44-9 |
| Literature: Rodriguez-Mata, Maria; Garcia-Urdiales, Eduardo; Gotor-Fernandez, Vicente; Gotor, Vicente Advanced Synthesis and Catalysis, 2010 , vol. 352, # 2-3 p. 395 - 406 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-Amino-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| MFCD02571869 |
| dl-3-amino-3-(4-trifluoromethyl-phenyl)-propionic acid |
| 4-Trifluoromethyl-DL-b-phenylalanine |
| 3-Amino-3-(4-trifluoromethyl-phenyl)-propionic acid |
| 3-amino-3-(4-(trifluoromethyl)phenyl)propanoic acid |
| 3-Amino-3-(4-trifluoromethylphenyl)-propionic acid |
| dl-3-amino-3-(4-trifluoromethyl-phenyl)-phenylpropionic acid |