Benzeneacetamide,N-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxy-3-(phenylmethoxy)- structure
|
Common Name | Benzeneacetamide,N-[2-(3,4-dimethoxyphenyl)ethyl]-4-methoxy-3-(phenylmethoxy)- | ||
|---|---|---|---|---|
| CAS Number | 18028-10-9 | Molecular Weight | 435.51200 | |
| Density | 1.15g/cm3 | Boiling Point | 639.4ºC at 760mmHg | |
| Molecular Formula | C26H29NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.5ºC | |
| Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-methoxy-3-phenylmethoxyphenyl)acetamide |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 639.4ºC at 760mmHg |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.51200 |
| Flash Point | 340.5ºC |
| Exact Mass | 435.20500 |
| PSA | 66.02000 |
| LogP | 4.58370 |
| Vapour Pressure | 3.02E-16mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | WZZFLNQCSFTAQT-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNC(=O)Cc2ccc(OC)c(OCc3ccccc3)c2)cc1OC |
|
~%
Benzeneacetamid... CAS#:18028-10-9 |
| Literature: Ploypradith, Poonsakdi; Petchmanee, Thaninee; Sahakitpichan, Poolsak; Litvinas, Nichole D.; Ruchirawat, Somsak Journal of Organic Chemistry, 2006 , vol. 71, # 25 p. 9440 - 9448 |
|
~%
Benzeneacetamid... CAS#:18028-10-9 |
| Literature: Ploypradith, Poonsakdi; Petchmanee, Thaninee; Sahakitpichan, Poolsak; Litvinas, Nichole D.; Ruchirawat, Somsak Journal of Organic Chemistry, 2006 , vol. 71, # 25 p. 9440 - 9448 |
|
~%
Benzeneacetamid... CAS#:18028-10-9 |
| Literature: McDonald, Edward; Wylie, Robert D. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1104 - 1108 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |