Benzeneacetic acid,4-methoxy-3-(phenylmethoxy) structure
|
Common Name | Benzeneacetic acid,4-methoxy-3-(phenylmethoxy) | ||
|---|---|---|---|---|
| CAS Number | 5487-33-2 | Molecular Weight | 272.29600 | |
| Density | 1.207g/cm3 | Boiling Point | 440.1ºC at 760mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(Benzyloxy)-4-methoxyphenylacetic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 440.1ºC at 760mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Exact Mass | 272.10500 |
| PSA | 55.76000 |
| LogP | 2.90130 |
| Index of Refraction | 1.581 |
| InChIKey | WXWWJUKMWNYILA-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)O)cc1OCc1ccccc1 |
| Hazard Codes | C |
|---|---|
| HS Code | 2918990090 |
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(4-methoxy-3-phenylmethoxyphenyl)acetic acid |