Benzoic acid, 2-[(2,3-dimethylphenyl)amino]-, monosodium salt structure
|
Common Name | Benzoic acid, 2-[(2,3-dimethylphenyl)amino]-, monosodium salt | ||
|---|---|---|---|---|
| CAS Number | 1804-47-3 | Molecular Weight | 263.26700 | |
| Density | N/A | Boiling Point | 398.8ºC at 760 mmHg | |
| Molecular Formula | C15H14NNaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,2-(2,3-dimethylanilino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 398.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H14NNaO2 |
| Molecular Weight | 263.26700 |
| Exact Mass | 263.09200 |
| PSA | 52.16000 |
| LogP | 2.48350 |
| Vapour Pressure | 4.45E-07mmHg at 25°C |
| InChIKey | IMCFRCUCBHZBTN-UHFFFAOYSA-M |
| SMILES | Cc1cccc(Nc2ccccc2C(=O)[O-])c1C.[Na+] |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| sodium 2-[(2,3-dimethylphenyl)amino]benzoate |
| Sodium mephenamate |
| 2-(2,3-dimethyl-anilino)-benzoic acid,sodium salt |
| Mephenamic acid sodium salt |
| mefenamic acid sodium salt |
| CI-473 sodium salt |
| sodium N-(2,3-dimethylphenyl)-anthranilate |
| Anthranilic acid,N-2,3-xylyl-,monosodium salt |
| N-2,3-Xylylanthranilic acid sodium salt |
| Sodium mefenamate |
| Sodium N-2,3-xylylanthranilate |