[Dimethyl(phenyl)silyl]methyl methacrylate structure
|
Common Name | [Dimethyl(phenyl)silyl]methyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 18052-92-1 | Molecular Weight | 234.366 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 296.4±23.0 °C at 760 mmHg | |
| Molecular Formula | C13H18O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.4±14.2 °C | |
| Name | [dimethyl(phenyl)silyl]methyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 296.4±23.0 °C at 760 mmHg |
| Molecular Formula | C13H18O2Si |
| Molecular Weight | 234.366 |
| Flash Point | 113.4±14.2 °C |
| Exact Mass | 234.107605 |
| PSA | 26.30000 |
| LogP | 4.78 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | RKFUZDIZLQCJKA-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC[Si](C)(C)c1ccccc1 |
| Storage condition | below 5° C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| methacrylic acid-[(dimethyl-phenyl-silanyl)-methyl ester] |
| 2-Propenoic acid, 2-methyl-, (dimethylphenylsilyl)methyl ester |
| (PHENYLDIMETHYLSILYL)METHYL METHACRYLATE |
| [Dimethyl(phenyl)silyl]methyl methacrylate |
| Methacryloyloxymethyl-dimethyl-phenyl-silan |
| Methacrylsaeure-[(dimethyl-phenyl-silyl)-methylester] |
| 2-Propenoic acid,2-methyl-,(dimethylphenylsilyl)methyl ester |
| Methacrylicacid,(dimethylphenylsilyl)methyl ester (6CI,8CI) |