2-Chloro-4'-fluorobenzophenone structure
|
Common Name | 2-Chloro-4'-fluorobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 1806-23-1 | Molecular Weight | 234.653 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 337.3±22.0 °C at 760 mmHg | |
| Molecular Formula | C13H8ClFO | Melting Point | 60-62°C | |
| MSDS | N/A | Flash Point | 157.8±22.3 °C | |
| Name | (2-chlorophenyl)-(4-fluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.3±22.0 °C at 760 mmHg |
| Melting Point | 60-62°C |
| Molecular Formula | C13H8ClFO |
| Molecular Weight | 234.653 |
| Flash Point | 157.8±22.3 °C |
| Exact Mass | 234.024765 |
| PSA | 17.07000 |
| LogP | 3.57 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | DODIKYQYCCFWRZ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)c1ccccc1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R21 |
| Safety Phrases | S28 |
| HS Code | 2914700090 |
|
~63%
2-Chloro-4'-flu... CAS#:1806-23-1 |
| Literature: Parella, Ramarao; Naveen; Kumar, Amit; Babu, Srinivasarao Arulananda Tetrahedron Letters, 2013 , vol. 54, # 13 p. 1738 - 1742 |
|
~78%
2-Chloro-4'-flu... CAS#:1806-23-1 |
| Literature: Mitsui Toatsu Chemicals, Inc. Patent: US4453009 A1, 1984 ; |
|
~%
2-Chloro-4'-flu... CAS#:1806-23-1 |
| Literature: US6348631 B1, ; Page column 19 ; |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| o-chlorophenyl p-fluorophenyl ketone |
| 4-Fluor-2'-chlor-benzophenon |
| EINECS 217-300-4 |
| (2-Chlorophenyl)(4-fluorophenyl)methanone |
| MFCD00000559 |
| Methanone, (2-chlorophenyl)(4-fluorophenyl)- |
| 2-Chloro-4'-fluorobenzophenone |