1-acetoxy-4-acetoxyimino-1,4-dihydroquinoline structure
|
Common Name | 1-acetoxy-4-acetoxyimino-1,4-dihydroquinoline | ||
|---|---|---|---|---|
| CAS Number | 18061-48-8 | Molecular Weight | 260.24500 | |
| Density | 1.26g/cm3 | Boiling Point | 353.9ºC at 760mmHg | |
| Molecular Formula | C13H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.8ºC | |
| Name | [(1-acetyloxyquinolin-4-ylidene)amino] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 353.9ºC at 760mmHg |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.24500 |
| Flash Point | 167.8ºC |
| Exact Mass | 260.08000 |
| PSA | 69.89000 |
| LogP | 0.99520 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | HGGQOJCRQGAQBU-WYMLVPIESA-N |
| SMILES | CC(=O)ON=c1ccn(OC(C)=O)c2ccccc12 |
| HS Code | 2933499090 |
|---|
|
~%
1-acetoxy-4-ace... CAS#:18061-48-8 |
| Literature: Demeunynck,M.; Tohme,N.; Lhomme,M. Journal of the American Chemical Society, 1986 , vol. 108, p. 3539 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Acetoxy-4-acetoxyimino-1,4-dihydrochinolin |
| O,O'-Diacetyl-4-hydroxyaminoquinoline 1-oxide |