4,5-Difluoro-2-nitropyridine
Modify Date: 2025-08-30 11:01:33
4,5-Difluoro-2-nitropyridine structure
|
Common Name | 4,5-Difluoro-2-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 1806371-17-4 | Molecular Weight | 160.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H2F2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,5-Difluoro-2-nitropyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H2F2N2O2 |
|---|---|
| Molecular Weight | 160.08 |
| InChIKey | AOPPOJSYHSYZOC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(F)c(F)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4,5-Difluoro-2-nitropyridine? |
| A: The English name of 4,5-Difluoro-2-nitropyridine is 4,5-Difluoro-2-nitropyridine. |
| Q: What is the InChIKey of 4,5-Difluoro-2-nitropyridine? |
| A: InChIKey of 4,5-Difluoro-2-nitropyridine is AOPPOJSYHSYZOC-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4,5-Difluoro-2-nitropyridine? |
| A: Molecular formula of 4,5-Difluoro-2-nitropyridine is C5H2F2N2O2. |
| Q: What is the molecular weight of 4,5-Difluoro-2-nitropyridine? |
| A: Molecular weight of 4,5-Difluoro-2-nitropyridine is 160.08. |
| Q: What is the SMILES notation of 4,5-Difluoro-2-nitropyridine? |
| A: SMILES notation of 4,5-Difluoro-2-nitropyridine is O=[N+]([O-])c1cc(F)c(F)cn1. |
| Q: What is the Chinese name of 1806371-17-4? |
| A: Chinese name of 1806371-17-4 is 1806371-17-4. |
| Q: What is the CAS number of 4,5-Difluoro-2-nitropyridine? |
| A: CAS number of 4,5-Difluoro-2-nitropyridine is 1806371-17-4. |