ethyl N-salicyloylanthranilate structure
|
Common Name | ethyl N-salicyloylanthranilate | ||
|---|---|---|---|---|
| CAS Number | 18066-04-1 | Molecular Weight | 285.29500 | |
| Density | 1.29g/cm3 | Boiling Point | 381.4ºC at 760mmHg | |
| Molecular Formula | C16H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.4ºC | |
| Name | ethyl 2-[(2-hydroxybenzoyl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 381.4ºC at 760mmHg |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.29500 |
| Flash Point | 184.4ºC |
| Exact Mass | 285.10000 |
| PSA | 75.63000 |
| LogP | 2.89420 |
| Vapour Pressure | 2.33E-06mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | IFSMESGPJPDOED-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1ccccc1O |
| HS Code | 2924299090 |
|---|
|
~%
ethyl N-salicyl... CAS#:18066-04-1 |
| Literature: Hoffmann-La Roche and Co. Patent: DE284735 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 678 |
|
~%
ethyl N-salicyl... CAS#:18066-04-1 |
| Literature: Hoffmann-La Roche and Co. Patent: DE284735 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 678 |
|
~%
ethyl N-salicyl... CAS#:18066-04-1 |
| Literature: Hoffmann-La Roche and Co. Patent: DE284735 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 678 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Salicoyl-anthranilsaeureaethylester |
| N-Salicyloyl-anthranilsaeure-aethylester |
| N-(2-Hydroxybenzoyl)-anthranilsaeure-methylester |
| EINECS 241-973-3 |
| Anthranilicacid,N-salicyloyl-,ethyl ester (8CI) |
| 2-Salicoylamino-benzoesaeureaethylester |
| 2'-Carboethoxysalicylanilid |
| Benzoic acid,2-[(2-hydroxybenzoyl)amino]-,ethyl ester |
| Ethyl N-salicyloylanthranilate |
| N-salicyloyl-anthranilic acid ethyl ester |