Ald-Ph-amido-PEG2-C2-NHS ester structure
|
Common Name | Ald-Ph-amido-PEG2-C2-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1807521-07-8 | Molecular Weight | 406.387 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H22N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ald-Ph-amido-PEG2-C2-NHS esterAld-Ph-amido-PEG2-C2-NHS ester is a nonclaevable 2-unit PEG linker for antibody-drug-conjugation (ADC). |
| Name | N-[2-(2-{3-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy}ethoxy)ethyl]-4-formylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Ald-Ph-amido-PEG2-C2-NHS ester is a nonclaevable 2-unit PEG linker for antibody-drug-conjugation (ADC). |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C19H22N2O8 |
| Molecular Weight | 406.387 |
| Exact Mass | 406.137604 |
| LogP | -1.35 |
| Index of Refraction | 1.569 |
| InChIKey | GNTMWHHLUUIRGC-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(C(=O)NCCOCCOCCC(=O)ON2C(=O)CCC2=O)cc1 |
| N-[2-(2-{3-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy}ethoxy)ethyl]-4-formylbenzamide |
| Benzamide, N-[2-[2-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropoxy]ethoxy]ethyl]-4-formyl- |