N3-PEG3-C2-PFP ester structure
|
Common Name | N3-PEG3-C2-PFP ester | ||
|---|---|---|---|---|
| CAS Number | 1807530-07-9 | Molecular Weight | 413.297 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16F5N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N3-PEG3-C2-PFP esterN3-PEG3-C2-PFP ester is a nonclaevable 3-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). |
| Name | Azido-PEG3-PFP ester |
|---|---|
| Synonym | More Synonyms |
| Description | N3-PEG3-C2-PFP ester is a nonclaevable 3-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| Molecular Formula | C15H16F5N3O5 |
|---|---|
| Molecular Weight | 413.297 |
| Exact Mass | 413.101013 |
| LogP | 2.02 |
| InChIKey | ZBZNPFUVVAAJIK-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| N3-PEG3-PFP ESTER |