N3-PEG2-C2-PFP ester structure
|
Common Name | N3-PEG2-C2-PFP ester | ||
|---|---|---|---|---|
| CAS Number | 1393330-37-4 | Molecular Weight | 369.244 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12F5N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N3-PEG2-C2-PFP esterN3-PEG2-C2-PFP ester is a nonclaevable 2-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). |
| Name | Pentafluorophenyl 3-[2-(2-azidoethoxy)ethoxy]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | N3-PEG2-C2-PFP ester is a nonclaevable 2-unit PEG linker used in the synthesis of antibody-drug conjugates (ADCs). |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| Molecular Formula | C13H12F5N3O4 |
|---|---|
| Molecular Weight | 369.244 |
| Exact Mass | 369.074799 |
| LogP | 2.38 |
| InChIKey | FEXHEMGARNABFF-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| MFCD22574800 |
| Propanoic acid, 3-[2-(2-azidoethoxy)ethoxy]-, 2,3,4,5,6-pentafluorophenyl ester |
| Pentafluorophenyl 3-[2-(2-azidoethoxy)ethoxy]propanoate |