PEG3-bis(phosphonic acid diethyl ester) structure
|
Common Name | PEG3-bis(phosphonic acid diethyl ester) | ||
|---|---|---|---|---|
| CAS Number | 1807539-03-2 | Molecular Weight | 422.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H32O10P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PEG3-bis(phosphonic acid diethyl ester)PEG3-bis(phosphonic acid diethyl ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | PEG4-bis(phosphonic acid diethyl ester) |
|---|---|
| Synonym | More Synonyms |
| Description | PEG3-bis(phosphonic acid diethyl ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C14H32O10P2 |
|---|---|
| Molecular Weight | 422.35 |
| InChIKey | WGTDVLYYVZBRNQ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)OCCOCCOCCOP(=O)(OCC)OCC |
| MFCD26127818 |