Fluorescein-PEG3-Amine structure
|
Common Name | Fluorescein-PEG3-Amine | ||
|---|---|---|---|---|
| CAS Number | 1807539-04-3 | Molecular Weight | 581.637 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 827.9±75.0 °C at 760 mmHg | |
| Molecular Formula | C29H31N3O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 454.5±37.1 °C | |
Use of Fluorescein-PEG3-AmineFluorescein-PEG3-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Fluorescein-PEG3-Amine |
|---|---|
| Synonym | More Synonyms |
| Description | Fluorescein-PEG3-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 827.9±75.0 °C at 760 mmHg |
| Molecular Formula | C29H31N3O8S |
| Molecular Weight | 581.637 |
| Flash Point | 454.5±37.1 °C |
| Exact Mass | 581.183167 |
| LogP | 1.14 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | SQJRQGZXMBEAHI-UHFFFAOYSA-N |
| SMILES | NCCOCCOCCOCCNC(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| Benzoic acid, 5-[(13-amino-1-thioxo-5,8,11-trioxa-2-azatridec-1-yl)amino]-2-(6-hydroxy-3-oxo-3H-xanthen-9-yl)- |
| 5-{[(2-{2-[2-(2-Aminoethoxy)ethoxy]ethoxy}ethyl)carbamothioyl]amino}-2-(6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid |
| MFCD23726633 |