1-(2-fluorophenyl)sulfonylpyrrole-2-carboxylic acid
Modify Date: 2025-08-27 10:10:59
1-(2-fluorophenyl)sulfonylpyrrole-2-carboxylic acid structure
|
Common Name | 1-(2-fluorophenyl)sulfonylpyrrole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 180905-86-6 | Molecular Weight | 269.24900 | |
| Density | 1.48g/cm3 | Boiling Point | 501.8ºC at 760 mmHg | |
| Molecular Formula | C11H8FNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.3ºC | |
| Name | 1-(2-fluorophenyl)sulfonylpyrrole-2-carboxylic acid |
|---|
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 501.8ºC at 760 mmHg |
| Molecular Formula | C11H8FNO4S |
| Molecular Weight | 269.24900 |
| Flash Point | 257.3ºC |
| Exact Mass | 269.01600 |
| PSA | 84.75000 |
| LogP | 2.64320 |
| Vapour Pressure | 6.83E-11mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | WDTCGKUXRJFGOG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccn1S(=O)(=O)c1ccccc1F |
|
~35%
1-(2-fluorophen... CAS#:180905-86-6 |
| Literature: Artico; Silvestri; Pagnozzi; Stefancich; Massa; Loi; Putzolu; Corrias; Spiga; La Colla Bioorganic and Medicinal Chemistry, 1996 , vol. 4, # 6 p. 837 - 850 |
|
~%
1-(2-fluorophen... CAS#:180905-86-6 |
| Literature: Artico; Silvestri; Pagnozzi; Stefancich; Massa; Loi; Putzolu; Corrias; Spiga; La Colla Bioorganic and Medicinal Chemistry, 1996 , vol. 4, # 6 p. 837 - 850 |
|
~%
1-(2-fluorophen... CAS#:180905-86-6 |
| Literature: Artico; Silvestri; Pagnozzi; Stefancich; Massa; Loi; Putzolu; Corrias; Spiga; La Colla Bioorganic and Medicinal Chemistry, 1996 , vol. 4, # 6 p. 837 - 850 |
