1,4-Naphthalenedione,2-[3-[4-(acetyloxy)phenyl]propyl]-3-hydroxy- structure
|
Common Name | 1,4-Naphthalenedione,2-[3-[4-(acetyloxy)phenyl]propyl]-3-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 18093-50-0 | Molecular Weight | 350.36500 | |
| Density | 1.307g/cm3 | Boiling Point | 543ºC at 760 mmHg | |
| Molecular Formula | C21H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.3ºC | |
| Name | [4-[3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)propyl]phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.307g/cm3 |
|---|---|
| Boiling Point | 543ºC at 760 mmHg |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.36500 |
| Flash Point | 193.3ºC |
| Exact Mass | 350.11500 |
| PSA | 80.67000 |
| LogP | 3.82590 |
| Vapour Pressure | 1.27E-12mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | XOTAVFQAFUHENE-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(CCCC2=C(O)c3ccccc3C(=O)C2=O)cc1 |
|
~%
1,4-Naphthalene... CAS#:18093-50-0 |
| Literature: Bullock Journal of medicinal chemistry, 1968 , vol. 11, # 3 p. 419 - 424 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-[3-(p-Acetoxyphenyl)-propyl]-2-hydroxy-1,4-naphthochinon |
| 4-[3-(1-hydroxy-3,4-dioxo-3,4-dihydronaphthalen-2-yl)propyl]phenyl acetate |