1OH-2BocNH-3PhPr [17]Metacyclophane deriv. structure
|
Common Name | 1OH-2BocNH-3PhPr [17]Metacyclophane deriv. | ||
|---|---|---|---|---|
| CAS Number | 180968-41-6 | Molecular Weight | 642.78300 | |
| Density | 1.11g/cm3 | Boiling Point | 887.6ºC at 760mmHg | |
| Molecular Formula | C34H50N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 490.6ºC | |
| Name | tert-butyl N-[(1R,2S)-1-[(4R,7S)-5,8-dioxo-7-propan-2-yl-12,15,18-trioxa-3,6,9-triazabicyclo[17.3.1]tricosa-1(23),19,21-trien-4-yl]-1-hydroxy-3-phenylpropan-2-yl]carbamate |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 887.6ºC at 760mmHg |
| Molecular Formula | C34H50N4O8 |
| Molecular Weight | 642.78300 |
| Flash Point | 490.6ºC |
| Exact Mass | 642.36300 |
| PSA | 166.95000 |
| LogP | 3.40930 |
| Vapour Pressure | 8.59E-34mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | DQRZWWANHBNSDX-VZNYXHRGSA-N |
| SMILES | CC(C)C1NC(=O)C(C(O)C(Cc2ccccc2)NC(=O)OC(C)(C)C)NCc2cccc(c2)OCCOCCOCCNC1=O |
|
~%
1OH-2BocNH-3PhP... CAS#:180968-41-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 39, # 17 p. 3291 - 3299 |
|
~%
1OH-2BocNH-3PhP... CAS#:180968-41-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 39, # 17 p. 3291 - 3299 |