B 9430 structure
|
Common Name | B 9430 | ||
|---|---|---|---|---|
| CAS Number | 180981-09-3 | Molecular Weight | 1338.559 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C64H95N19O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of B 9430B 9430 is a potent bradykinin B1/B2 receptor antagonist[1]. |
| Name | B-9430 TRIFLUOROACETATE SALT |
|---|---|
| Synonym | More Synonyms |
| Description | B 9430 is a potent bradykinin B1/B2 receptor antagonist[1]. |
|---|---|
| Related Catalog | |
| Target |
Bradykinin B1 Receptor (B1R) Bradykinin B2 Receptor (B2R) |
| In Vivo | B 9430 decreases the number of leukocytes attached to the endothelial surface and alleviate cerebral microcirculation in gerbil after global cerebral ischemia[1]. |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C64H95N19O13 |
| Molecular Weight | 1338.559 |
| Exact Mass | 1337.735718 |
| LogP | 0.12 |
| Appearance of Characters | Solid |
| Index of Refraction | 1.740 |
| InChIKey | PVNQRMOWAXFQHU-UHFFFAOYSA-N |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)N1CC(O)CC1C(=O)NCC(=O)NC(C(=O)NC(CO)C(=O)NC(C(=O)N1C(C(=O)NC(CCCN=C(N)N)C(=O)O)CC2CCCCC21)C1Cc2ccccc2C1)C1Cc2ccccc2C1 |
| Storage condition | ?20°C |
| Glycinamide, N5-(diaminomethylene)-D-ornithyl-N5-(diaminomethylene)-L-ornithyl-L-prolyl-(4R)-4-hydroxy-L-prolyl-N-[(1S)-2-[[(1S)-2-[[(1R)-2-[(2S,3aS,7aS)-2-[[[(1S)-1-carboxy-4-[(diaminomethylene)a ; mino]butyl]amino]carbonyl]octahydro-1H-indol-1-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]amino]-1-(hydroxymethyl)-2-oxoethyl]amino]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]- |
| N5-(Diaminomethylene)-D-ornithyl-N5-(diaminomethylene)-L-ornithyl-L-prolyl-(4R)-4-hydroxy-L-prolyl-N-[(1S)-2-{[(2S)-1-{[(1R)-2-[(2S,3aS,7aS)-2-({(1S)-1-carboxy-4-[(diaminomethylene)amino]butyl}car bamoyl)octahydro-1H-indol-1-yl]-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]amino}-3-hydroxy-1-oxo-2-propanyl]amino}-1-(2,3-dihydro-1H-inden-2-yl)-2-oxoethyl]glycinamide |