6-(1,3-dioxo-6-(piperidin-1-yl)-1H-benzo[de]isoquinolin-2(3H)-yl)hexanoic acid structure
|
Common Name | 6-(1,3-dioxo-6-(piperidin-1-yl)-1H-benzo[de]isoquinolin-2(3H)-yl)hexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 181373-35-3 | Molecular Weight | 394.46400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H26N2O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 6-(1,3-dioxo-6-(piperidin-1-yl)-1H-benzo[de]isoquinolin-2(3H)-yl)hexanoic acidNS1-IN-1 (compound 3) is a potent NS1 inhibitor. NS1 is a major influenza A virus virulence factor that inhibits host gene expression. NS1-IN-1 decreases viral protein levels, contributing to the reduction of virus replication. NS1-IN-1 shows antiviral activity by repressing the activity of mTORC1 in a TSC1-TSC2-dependent manner[1]. |
| Name | 6-(1,3-dioxo-6-(piperidin-1-yl)-1H-benzo[de]isoquinolin-2(3H)-yl)hexanoic acid |
|---|
| Description | NS1-IN-1 (compound 3) is a potent NS1 inhibitor. NS1 is a major influenza A virus virulence factor that inhibits host gene expression. NS1-IN-1 decreases viral protein levels, contributing to the reduction of virus replication. NS1-IN-1 shows antiviral activity by repressing the activity of mTORC1 in a TSC1-TSC2-dependent manner[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H26N2O4 |
|---|---|
| Molecular Weight | 394.46400 |
| Exact Mass | 394.18900 |
| PSA | 79.61000 |
| LogP | 3.65300 |
| InChIKey | MBIOYMJZOCQPAE-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCN1C(=O)c2cccc3c(N4CCCCC4)ccc(c23)C1=O |