Ethiprole structure
|
Common Name | Ethiprole | ||
|---|---|---|---|---|
| CAS Number | 181587-01-9 | Molecular Weight | 397.20300 | |
| Density | 1.69g/cm3 | Boiling Point | 563.5ºC at 760mmHg | |
| Molecular Formula | C13H9Cl2F3N4OS | Melting Point | ~174° | |
| MSDS | USA | Flash Point | 294.6ºC | |
| Symbol |
GHS08, GHS09 |
Signal Word | Warning | |
Use of EthiproleEthiprole is an insecticide.Metabolic sulfones are produced faster than Fipronil (HY-B0822) in CYP3A4-expressing cells and in vivo in mouse brain and liver.Ethiprole's sulfide, sulfoxide, sulfone and desulfinyl derivatives have better biological activity[1]. |
| Name | ethiprole |
|---|---|
| Synonym | More Synonyms |
| Description | Ethiprole is an insecticide.Metabolic sulfones are produced faster than Fipronil (HY-B0822) in CYP3A4-expressing cells and in vivo in mouse brain and liver.Ethiprole's sulfide, sulfoxide, sulfone and desulfinyl derivatives have better biological activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.69g/cm3 |
|---|---|
| Boiling Point | 563.5ºC at 760mmHg |
| Melting Point | ~174° |
| Molecular Formula | C13H9Cl2F3N4OS |
| Molecular Weight | 397.20300 |
| Flash Point | 294.6ºC |
| Exact Mass | 395.98300 |
| PSA | 103.91000 |
| LogP | 5.22618 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | FNELVJVBIYMIMC-UHFFFAOYSA-N |
| SMILES | CCS(=O)c1c(C#N)nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c1N |
| Storage condition | 0-6°C |
| Symbol |
GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H373-H410 |
| Precautionary Statements | P273-P501 |
| Target Organs | Liver, Thyroid. |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Phrases | R23/24/25 |
| Safety Phrases | S36/37 |
| RIDADR | UN2811 6.1/PG 3 |
|
~94%
Ethiprole CAS#:181587-01-9 |
| Literature: Tang, Ri-Yuan; Zhong, Ping; Lin, Qiu-Lian Journal of Fluorine Chemistry, 2006 , vol. 127, # 7 p. 948 - 953 |
|
~%
Ethiprole CAS#:181587-01-9 |
| Literature: Journal of Fluorine Chemistry, , vol. 127, # 7 p. 948 - 953 |
| Ethiprole |
| UNII-5527E53JNB |
| 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(ethylsulfinyl)-1H-pyrazole-3-carbonitrile |
| 5-amino-1-(2,6-dichloro-α,α,α-trifluoro-p-tolyl)-4-ethylsulfinylpyrazole-3-carbonitrile |
| 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-ethylsulfinylpyrazole-3-carbonitrile |
| 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(ethanesulfinyl)-1H-pyrazole-3-carbonitrile |