Chloromethyl Triisopropoxysilane structure
|
Common Name | Chloromethyl Triisopropoxysilane | ||
|---|---|---|---|---|
| CAS Number | 18162-82-8 | Molecular Weight | 254.82600 | |
| Density | 0.962 g/mL at 25ºC(lit.) | Boiling Point | 246.959ºC at 760 mmHg | |
| Molecular Formula | C10H23ClO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181 °F | |
| Name | chloromethyl-tri(propan-2-yloxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.962 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 246.959ºC at 760 mmHg |
| Molecular Formula | C10H23ClO3Si |
| Molecular Weight | 254.82600 |
| Flash Point | 181 °F |
| Exact Mass | 254.11000 |
| PSA | 27.69000 |
| LogP | 3.39660 |
| Vapour Pressure | 0.041mmHg at 25°C |
| Index of Refraction | 1.427 |
| InChIKey | SAKYAANYXZKYEK-UHFFFAOYSA-N |
| SMILES | CC(C)O[Si](CCl)(OC(C)C)OC(C)C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R37/38 |
| Safety Phrases | S26 |
| WGK Germany | 3.0 |
| HS Code | 2931900090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| chloromethyltriisopropoxysilane |
| Silane,(chloromethyl)tris(1-methylethoxy) |
| MFCD05664343 |
| Chlormethyl-triisopropoxy-silan |
| Chloromethyl Triisopropoxysilane |