S,S,S-tris(2-ethylhexyl)phosphorotrithioate structure
|
Common Name | S,S,S-tris(2-ethylhexyl)phosphorotrithioate | ||
|---|---|---|---|---|
| CAS Number | 181629-03-8 | Molecular Weight | 482.83000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H51OPS3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 3-[bis(2-ethylhexylsulfanyl)phosphorylsulfanylmethyl]heptane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H51OPS3 |
|---|---|
| Molecular Weight | 482.83000 |
| Exact Mass | 482.28400 |
| PSA | 102.78000 |
| LogP | 10.94330 |
| InChIKey | ZYMYBLYKQDZTEH-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CSP(=O)(SCC(CC)CCCC)SCC(CC)CCCC |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 |
| Precautionary Statements | P280-P301 + P310-P312 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R24/25 |
| Safety Phrases | S36/37 |
| RIDADR | UN3278 6.1/PG 3 |
|
Serotonin-Selective Membrane Electrode Made with the Solvent Mediator S,S,S-Tris(2-ethylhexyl)phosphorotrithioate T.Katsu, H.Hirodo
Sens. Lett. 1 , 99-101, (2003)
|
|
|
S,S,S-Tris(2-ethylhexyl) phosphorotrithioate as an effective solvent mediator for a mexiletine-sensitive membrane electrode.
Anal. Bioanal. Chem 387 , 2057-2064, (2007) S,S,S-tris(2-ethylhexyl) phosphorotrithioate proved to be an effective solvent mediator for constructing a mexiletine-sensitive membrane electrode in combination with an ion-exchanger, sodium tetrakis... |
| s,s,s-tris(2-ethylhexyl)phosphorotrithioate |