Benzenesulfonyl fluoride,4-[[(4-methoxyphenyl)amino]carbonyl]- structure
|
Common Name | Benzenesulfonyl fluoride,4-[[(4-methoxyphenyl)amino]carbonyl]- | ||
|---|---|---|---|---|
| CAS Number | 18167-28-7 | Molecular Weight | 309.31300 | |
| Density | 1.386g/cm3 | Boiling Point | 373.2ºC at 760mmHg | |
| Molecular Formula | C14H12FNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.5ºC | |
| Name | 4-[(4-methoxyphenyl)carbamoyl]benzenesulfonyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 373.2ºC at 760mmHg |
| Molecular Formula | C14H12FNO4S |
| Molecular Weight | 309.31300 |
| Flash Point | 179.5ºC |
| Exact Mass | 309.04700 |
| PSA | 80.85000 |
| LogP | 3.75950 |
| Vapour Pressure | 9.13E-06mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | OTKWKQUEVRRRQJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)c2ccc(S(=O)(=O)F)cc2)cc1 |
|
~%
Benzenesulfonyl... CAS#:18167-28-7 |
| Literature: Baker; Erickson Journal of medicinal chemistry, 1968 , vol. 11, # 2 p. 245 - 249 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Fluorsulfonyl-4'-methoxybenzanilid |