Benzoyl chloride,4-(fluorosulfonyl)- structure
|
Common Name | Benzoyl chloride,4-(fluorosulfonyl)- | ||
|---|---|---|---|---|
| CAS Number | 402-55-1 | Molecular Weight | 222.62100 | |
| Density | 1.518g/cm3 | Boiling Point | 96-97ºC0.7 mm Hg(lit.) | |
| Molecular Formula | C7H4ClFO3S | Melting Point | 46-48ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 130.7ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 4-fluorosulfonylbenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.518g/cm3 |
|---|---|
| Boiling Point | 96-97ºC0.7 mm Hg(lit.) |
| Melting Point | 46-48ºC(lit.) |
| Molecular Formula | C7H4ClFO3S |
| Molecular Weight | 222.62100 |
| Flash Point | 130.7ºC |
| Exact Mass | 221.95500 |
| PSA | 59.59000 |
| LogP | 2.80460 |
| Vapour Pressure | 0.00279mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | JMTAYFNTRRLWQG-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(S(=O)(=O)F)cc1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H314-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| Packaging Group | III |
| HS Code | 2916399090 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis and use of FSCPX, an irreversible adenosine A1 antagonist, as a 'receptor knock-down' tool.
Bioorg. Med. Chem. Lett. 11 , 815, (2001) A new preparative synthetic route for the irreversible adenosine A1 antagonist 8-cyclopentyl-3-N-[3-((3-(4-fluorosulphonyl)benzoyl)-oxy)-propyl]-1-N-propyl-xanthine (FSCPX, 1) is described. The availa... |
| Benzoylchlorid-sulfofluorid-(4) |
| 4-(Fluorosulfonyl)benzoyl chloride |
| p-fluorosulfonylbenzoyl chloride |
| EINECS 206-949-9 |
| MFCD00007419 |