4-Nitrocumene structure
|
Common Name | 4-Nitrocumene | ||
|---|---|---|---|---|
| CAS Number | 1817-47-6 | Molecular Weight | 165.189 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 236.4±0.0 °C at 760 mmHg | |
| Molecular Formula | C9H11NO2 | Melting Point | 2°C | |
| MSDS | N/A | Flash Point | 99.9±14.3 °C | |
| Name | 1-nitro-4-propan-2-ylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 236.4±0.0 °C at 760 mmHg |
| Melting Point | 2°C |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.189 |
| Flash Point | 99.9±14.3 °C |
| Exact Mass | 165.078979 |
| PSA | 45.82000 |
| LogP | 3.29 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | JXMYUMNAEKRMIP-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc([N+](=O)[O-])cc1 |
| Stability | Stable. Incompatible with strong bases, strong oxidizing agents. |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| EINECS 217-326-6 |
| 1-Isopropyl-4-nitrobenzene |
| 2-(p-Nitrophenyl)propane |
| 4-i-propyl-nitrobenzene |
| 4-ISOPROPYLNITROBENZENE |
| 4-Nitroisopropylbenzene |
| 4-Nitrocumene |
| p-Nitroisopropylbenzene |
| MFCD00039746 |
| p-Nitrocumene |
| 4-isopropyl-nitrobenzene |
| P-ISOPROPYLNITROBENZENE |
| Cumene,p-nitro |