2,4'-Dinitrdiphenylmethane
2,4'-Dinitrdiphenylmethane structure
|
Common Name | 2,4'-Dinitrdiphenylmethane | ||
|---|---|---|---|---|
| CAS Number | 1817-75-0 | Molecular Weight | 258.22900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O4 | Melting Point | 119ºC | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,4'-Dinitrdiphenylmethane (Chinese name: 2,4-二苯基甲烷二硝基, CAS number: 1817-75-0) is a chemical compound with molecular formula C13H10N2O4 and molecular weight 258.22900. Its melting point is 119°C. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4'-Dinitrdiphenylmethane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 119ºC |
|---|---|
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.22900 |
| Exact Mass | 258.06400 |
| PSA | 91.64000 |
| LogP | 4.14020 |
| InChIKey | CGLMICLDWFELRK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cc2ccccc2[N+](=O)[O-])cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2904209090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 1 | |
CAS#:101-81-5
CAS#:5840-40-4
CAS#:612-23-7
CAS#:71-43-2
CAS#:1817-77-2
CAS#:7697-37-2
CAS#:64-19-7
CAS#:1208-52-2This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dinitrdiphenylmethane |
| 2,3-DIFLUOROPHENETOLE |
| o,p'-Dinitro-diphenylmethan |
| 2,4-Dinitrdiphenylmethane |
| 2,4'-Dinitro-diphenylmethan |
| 2,4'-DINITRODIPHENYLMETHANE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,4'-Dinitrdiphenylmethane? |
| A: Polar surface area (PSA) of 2,4'-Dinitrdiphenylmethane is 91.64000. |
| Q: What English synonyms does 2,4'-Dinitrdiphenylmethane have? |
| A: English synonyms of 2,4'-Dinitrdiphenylmethane: Dinitrdiphenylmethane, 2,3-DIFLUOROPHENETOLE, o,p'-Dinitro-diphenylmethan, 2,4-Dinitrdiphenylmethane, 2,4'-Dinitro-diphenylmethan, 2,4'-DINITRODIPHENYLMETHANE. |
| Q: What are the upstream materials of 2,4'-Dinitrdiphenylmethane? |
| A: Related upstream materials(CAS) of 2,4'-Dinitrdiphenylmethane: 101-81-5;5840-40-4;612-23-7;71-43-2;1817-77-2;7697-37-2;64-19-7. |
| Q: What is the molecular formula of 2,4'-Dinitrdiphenylmethane? |
| A: Molecular formula of 2,4'-Dinitrdiphenylmethane is C13H10N2O4. |
| Q: What are the downstream products of 2,4'-Dinitrdiphenylmethane? |
| A: Related downstream products(CAS) of 2,4'-Dinitrdiphenylmethane: 1208-52-2. |
| Q: What is the English name of 2,4'-Dinitrdiphenylmethane? |
| A: The English name of 2,4'-Dinitrdiphenylmethane is 2,4'-Dinitrdiphenylmethane. |
| Q: What is the InChIKey of 2,4'-Dinitrdiphenylmethane? |
| A: InChIKey of 2,4'-Dinitrdiphenylmethane is CGLMICLDWFELRK-UHFFFAOYSA-N. |
| Q: What is the melting point of 2,4'-Dinitrdiphenylmethane? |
| A: Melting point of 2,4'-Dinitrdiphenylmethane is 119ºC. |
| Q: What is the SMILES notation of 2,4'-Dinitrdiphenylmethane? |
| A: SMILES notation of 2,4'-Dinitrdiphenylmethane is O=[N+]([O-])c1ccc(Cc2ccccc2[N+](=O)[O-])cc1. |
| Q: What is the LogP of 2,4'-Dinitrdiphenylmethane? |
| A: LogP of 2,4'-Dinitrdiphenylmethane is 4.14020. |